C20H35IO5Si — CID 154721874
methyl (2E,4S,5S,6E,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4-(methoxymethoxy)-6,8-dimethylnona-2,6,8-trienoate (PubChem CID 154721874) has the molecular formula C20H35IO5Si and a molecular weight of 510.49 g/mol. Its IUPAC name is methyl (2E,4S,5S,6E,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4-(methoxymethoxy)-6,8-dimethylnona-2,6,8-trienoate.
| Compound Name | methyl (2E,4S,5S,6E,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4-(methoxymethoxy)-6,8-dimethylnona-2,6,8-trienoate |
|---|---|
| PubChem CID | 154721874 |
| Molecular Formula | C20H35IO5Si |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | methyl (2E,4S,5S,6E,8Z)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4-(methoxymethoxy)-6,8-dimethylnona-2,6,8-trienoate |
| SMILES | COCO[C@@H](/C=C/C(=O)OC)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/C(C)=C\I |
| InChI | InChI=1S/C20H35IO5Si/c1-15(13-21)12-16(2)19(26-27(8,9)20(3,4)5)17(25-14-23-6)10-11-18(22)24-7/h10-13,17,19H,14H2,1-9H3/b11-10+,15-13-,16-12+/t17-,19-/m0/s1 |
| InChIKey | HZSHUOCWBWBQOC-NCUBTNDSSA-N |
| XLogP | 5.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|