C23H42O4Si — CID 11133370
ethyl (2E,4S,7E,9S)-2,4,8-trimethyl-6-methylidene-9-(2-trimethylsilylethoxymethoxy)undeca-2,7-dienoate (PubChem CID 11133370) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is ethyl (2E,4S,7E,9S)-2,4,8-trimethyl-6-methylidene-9-(2-trimethylsilylethoxymethoxy)undeca-2,7-dienoate.
| Compound Name | ethyl (2E,4S,7E,9S)-2,4,8-trimethyl-6-methylidene-9-(2-trimethylsilylethoxymethoxy)undeca-2,7-dienoate |
|---|---|
| PubChem CID | 11133370 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | ethyl (2E,4S,7E,9S)-2,4,8-trimethyl-6-methylidene-9-(2-trimethylsilylethoxymethoxy)undeca-2,7-dienoate |
| SMILES | C=C(/C=C(\C)[C@H](CC)OCOCC[Si](C)(C)C)C[C@H](C)/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C23H42O4Si/c1-10-22(27-17-25-12-13-28(7,8)9)20(5)15-18(3)14-19(4)16-21(6)23(24)26-11-2/h15-16,19,22H,3,10-14,17H2,1-2,4-9H3/b20-15+,21-16+/t19-,22-/m0/s1 |
| InChIKey | WLIBUUCVRCYYMD-ZASSVJRUSA-N |
| XLogP | 6.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|