C20H32O6Si — CID 54031107
ethyl 6-[6-oxo-4-(2-trimethylsilylethoxymethoxy)pyran-2-yl]hept-2-enoate (PubChem CID 54031107) has the molecular formula C20H32O6Si and a molecular weight of 396.56 g/mol. Its IUPAC name is ethyl 6-[6-oxo-4-(2-trimethylsilylethoxymethoxy)pyran-2-yl]hept-2-enoate.
| Compound Name | ethyl 6-[6-oxo-4-(2-trimethylsilylethoxymethoxy)pyran-2-yl]hept-2-enoate |
|---|---|
| PubChem CID | 54031107 |
| Molecular Formula | C20H32O6Si |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | ethyl 6-[6-oxo-4-(2-trimethylsilylethoxymethoxy)pyran-2-yl]hept-2-enoate |
| SMILES | CCOC(=O)C=CCCC(C)c1cc(OCOCC[Si](C)(C)C)cc(=O)o1 |
| InChI | InChI=1S/C20H32O6Si/c1-6-24-19(21)10-8-7-9-16(2)18-13-17(14-20(22)26-18)25-15-23-11-12-27(3,4)5/h8,10,13-14,16H,6-7,9,11-12,15H2,1-5H3 |
| InChIKey | LFQUKCIKJNSFOW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|