C18H32O6Si — CID 15463232
6-(5,5-dimethoxypentan-2-yl)-4-(2-trimethylsilylethoxymethoxy)pyran-2-one (PubChem CID 15463232) has the molecular formula C18H32O6Si and a molecular weight of 372.53 g/mol. Its IUPAC name is 6-(5,5-dimethoxypentan-2-yl)-4-(2-trimethylsilylethoxymethoxy)pyran-2-one.
| Compound Name | 6-(5,5-dimethoxypentan-2-yl)-4-(2-trimethylsilylethoxymethoxy)pyran-2-one |
|---|---|
| PubChem CID | 15463232 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 6-(5,5-dimethoxypentan-2-yl)-4-(2-trimethylsilylethoxymethoxy)pyran-2-one |
| SMILES | COC(CCC(C)c1cc(OCOCC[Si](C)(C)C)cc(=O)o1)OC |
| InChI | InChI=1S/C18H32O6Si/c1-14(7-8-18(20-2)21-3)16-11-15(12-17(19)24-16)23-13-22-9-10-25(4,5)6/h11-12,14,18H,7-10,13H2,1-6H3 |
| InChIKey | SQZBOVIXFOOACV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|