C19H30O5Si — CID 20653344
6-[(E)-7-oxooct-5-en-2-yl]-4-(2-trimethylsilylethoxymethoxy)pyran-2-one (PubChem CID 20653344) has the molecular formula C19H30O5Si and a molecular weight of 366.53 g/mol. Its IUPAC name is 6-[(E)-7-oxooct-5-en-2-yl]-4-(2-trimethylsilylethoxymethoxy)pyran-2-one.
| Compound Name | 6-[(E)-7-oxooct-5-en-2-yl]-4-(2-trimethylsilylethoxymethoxy)pyran-2-one |
|---|---|
| PubChem CID | 20653344 |
| Molecular Formula | C19H30O5Si |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 6-[(E)-7-oxooct-5-en-2-yl]-4-(2-trimethylsilylethoxymethoxy)pyran-2-one |
| SMILES | CC(=O)/C=C/CCC(C)c1cc(OCOCC[Si](C)(C)C)cc(=O)o1 |
| InChI | InChI=1S/C19H30O5Si/c1-15(8-6-7-9-16(2)20)18-12-17(13-19(21)24-18)23-14-22-10-11-25(3,4)5/h7,9,12-13,15H,6,8,10-11,14H2,1-5H3/b9-7+ |
| InChIKey | VAVVAHZCLNIDLP-VQHVLOKHSA-N |
| XLogP | 4.36 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|