C23H40O3Si — CID 11372787
(3E,5S,8S,9E,11Z)-5,11-dimethyl-8-tri(propan-2-yl)silyloxy-1-oxacyclotrideca-3,9,11-trien-2-one (PubChem CID 11372787) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is (3E,5S,8S,9E,11Z)-5,11-dimethyl-8-tri(propan-2-yl)silyloxy-1-oxacyclotrideca-3,9,11-trien-2-one.
| Compound Name | (3E,5S,8S,9E,11Z)-5,11-dimethyl-8-tri(propan-2-yl)silyloxy-1-oxacyclotrideca-3,9,11-trien-2-one |
|---|---|
| PubChem CID | 11372787 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (3E,5S,8S,9E,11Z)-5,11-dimethyl-8-tri(propan-2-yl)silyloxy-1-oxacyclotrideca-3,9,11-trien-2-one |
| SMILES | CC1=C/COC(=O)/C=C/[C@@H](C)CC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)\C=C\1 |
| InChI | InChI=1S/C23H40O3Si/c1-17(2)27(18(3)4,19(5)6)26-22-12-9-20(7)11-14-23(24)25-16-15-21(8)10-13-22/h10-11,13-15,17-20,22H,9,12,16H2,1-8H3/b13-10+,14-11+,21-15-/t20-,22-/m0/s1 |
| InChIKey | JVMMGYSGDCZKQL-SUIAQHIVSA-N |
| XLogP | 6.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|