C26H45BrO4Si — CID 10578118
(2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenal (PubChem CID 10578118) has the molecular formula C26H45BrO4Si and a molecular weight of 529.63 g/mol. Its IUPAC name is (2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenal.
| Compound Name | (2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenal |
|---|---|
| PubChem CID | 10578118 |
| Molecular Formula | C26H45BrO4Si |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | (2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenal |
| SMILES | COCO[C@H](/C=C(Br)/C=C/C(C)=C/CO[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@H](C)/C=C(\C)C=O |
| InChI | InChI=1S/C26H45BrO4Si/c1-20(13-14-31-32(9,10)26(5,6)7)11-12-24(27)17-25(30-19-29-8)23(4)16-21(2)15-22(3)18-28/h11-13,15,17-18,21,23,25H,14,16,19H2,1-10H3/b12-11+,20-13+,22-15+,24-17-/t21-,23+,25-/m1/s1 |
| InChIKey | JZOVLZITXXAWAM-PLPDLMQLSA-N |
| XLogP | 7.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|