C31H56O4Si — CID 54589624
(2E,4S,5S,6S,7E,9E,11E)-12-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4,10-triethyl-5-(methoxymethoxy)-6,8-dimethyltetradeca-2,7,9,11-tetraenal (PubChem CID 54589624) has the molecular formula C31H56O4Si and a molecular weight of 520.87 g/mol. Its IUPAC name is (2E,4S,5S,6S,7E,9E,11E)-12-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4,10-triethyl-5-(methoxymethoxy)-6,8-dimethyltetradeca-2,7,9,11-tetraenal.
| Compound Name | (2E,4S,5S,6S,7E,9E,11E)-12-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4,10-triethyl-5-(methoxymethoxy)-6,8-dimethyltetradeca-2,7,9,11-tetraenal |
|---|---|
| PubChem CID | 54589624 |
| Molecular Formula | C31H56O4Si |
| Molecular Weight | 520.87 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | (2E,4S,5S,6S,7E,9E,11E)-12-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4,10-triethyl-5-(methoxymethoxy)-6,8-dimethyltetradeca-2,7,9,11-tetraenal |
| SMILES | CC/C(C=O)=C\[C@H](CC)[C@@H](OCOC)[C@@H](C)/C=C(C)/C=C(/C=C(\CC)CO[Si](C)(C)C(C)(C)C)CC |
| InChI | InChI=1S/C31H56O4Si/c1-13-26(19-28(15-3)22-35-36(11,12)31(7,8)9)18-24(5)17-25(6)30(34-23-33-10)29(16-4)20-27(14-2)21-32/h17-21,25,29-30H,13-16,22-23H2,1-12H3/b24-17+,26-18+,27-20+,28-19+/t25-,29-,30-/m0/s1 |
| InChIKey | PGVSCEJDFIHSQU-FQQFEEISSA-N |
| XLogP | 8.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.87 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|