C28H48O4Si — CID 12991848
(2E,4E,6E,10E,12E,14R,15S,16S,17R)-17-[tert-butyl(dimethyl)silyl]oxy-15-(methoxymethoxy)-14,16-dimethyloctadeca-2,4,6,10,12-pentaenal (PubChem CID 12991848) has the molecular formula C28H48O4Si and a molecular weight of 476.77 g/mol. Its IUPAC name is (2E,4E,6E,10E,12E,14R,15S,16S,17R)-17-[tert-butyl(dimethyl)silyl]oxy-15-(methoxymethoxy)-14,16-dimethyloctadeca-2,4,6,10,12-pentaenal.
| Compound Name | (2E,4E,6E,10E,12E,14R,15S,16S,17R)-17-[tert-butyl(dimethyl)silyl]oxy-15-(methoxymethoxy)-14,16-dimethyloctadeca-2,4,6,10,12-pentaenal |
|---|---|
| PubChem CID | 12991848 |
| Molecular Formula | C28H48O4Si |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | (2E,4E,6E,10E,12E,14R,15S,16S,17R)-17-[tert-butyl(dimethyl)silyl]oxy-15-(methoxymethoxy)-14,16-dimethyloctadeca-2,4,6,10,12-pentaenal |
| SMILES | COCO[C@H]([C@H](C)[C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/C=C/CC/C=C/C=C/C=C/C=O |
| InChI | InChI=1S/C28H48O4Si/c1-24(21-19-17-15-13-11-10-12-14-16-18-20-22-29)27(31-23-30-7)25(2)26(3)32-33(8,9)28(4,5)6/h10,12,14-22,24-27H,11,13,23H2,1-9H3/b12-10+,16-14+,17-15+,20-18+,21-19+/t24-,25-,26-,27+/m1/s1 |
| InChIKey | TVHYMAMEXICYLB-NUOULVEOSA-N |
| XLogP | 7.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|