C30H50O5Si — CID 134970330
(2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-(2-methoxyethoxymethoxy)-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal (PubChem CID 134970330) has the molecular formula C30H50O5Si and a molecular weight of 518.81 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-(2-methoxyethoxymethoxy)-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal.
| Compound Name | (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-(2-methoxyethoxymethoxy)-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal |
|---|---|
| PubChem CID | 134970330 |
| Molecular Formula | C30H50O5Si |
| Molecular Weight | 518.81 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-(2-methoxyethoxymethoxy)-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal |
| SMILES | COCCOCO[C@@H](C)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/C=C/C=C/C=C/C=C/C=C/C=O |
| InChI | InChI=1S/C30H50O5Si/c1-26(21-19-17-15-13-11-10-12-14-16-18-20-22-31)29(35-36(8,9)30(4,5)6)27(2)28(3)34-25-33-24-23-32-7/h10-22,26-29H,23-25H2,1-9H3/b12-10+,13-11+,16-14+,17-15+,20-18+,21-19+/t26-,27-,28-,29+/m0/s1 |
| InChIKey | NHFWBFXNCSGVFF-LBRPAXHISA-N |
| XLogP | 7.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.81 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|