C24H46O4Si — CID 10949974
(2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-10-(1-ethoxyethoxy)-2,4,6,8-tetramethyldeca-2,8-dienal (PubChem CID 10949974) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is (2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-10-(1-ethoxyethoxy)-2,4,6,8-tetramethyldeca-2,8-dienal.
| Compound Name | (2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-10-(1-ethoxyethoxy)-2,4,6,8-tetramethyldeca-2,8-dienal |
|---|---|
| PubChem CID | 10949974 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-10-(1-ethoxyethoxy)-2,4,6,8-tetramethyldeca-2,8-dienal |
| SMILES | CCOC(C)OC/C=C(\C)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(\C)C=O |
| InChI | InChI=1S/C24H46O4Si/c1-12-26-22(6)27-14-13-18(2)15-20(4)23(21(5)16-19(3)17-25)28-29(10,11)24(7,8)9/h13,16-17,20-23H,12,14-15H2,1-11H3/b18-13+,19-16+/t20-,21+,22?,23-/m0/s1 |
| InChIKey | XRXZIEXVJBPTIC-ZHTNTTJHSA-N |
| XLogP | 6.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|