C22H35BrO5 — CID 10813790
ethyl (2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-hydroxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenoate (PubChem CID 10813790) has the molecular formula C22H35BrO5 and a molecular weight of 459.42 g/mol. Its IUPAC name is ethyl (2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-hydroxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenoate.
| Compound Name | ethyl (2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-hydroxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenoate |
|---|---|
| PubChem CID | 10813790 |
| Molecular Formula | C22H35BrO5 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | ethyl (2E,4S,6S,7S,8Z,10E,12E)-9-bromo-14-hydroxy-7-(methoxymethoxy)-2,4,6,12-tetramethyltetradeca-2,8,10,12-tetraenoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](C)C[C@H](C)[C@@H](/C=C(Br)/C=C/C(C)=C/CO)OCOC |
| InChI | InChI=1S/C22H35BrO5/c1-7-27-22(25)19(5)13-17(3)12-18(4)21(28-15-26-6)14-20(23)9-8-16(2)10-11-24/h8-10,13-14,17-18,21,24H,7,11-12,15H2,1-6H3/b9-8+,16-10+,19-13+,20-14-/t17-,18-,21+/m0/s1 |
| InChIKey | FQWIRHJPRWNHJG-HLIZLOKWSA-N |
| XLogP | 4.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|