C25H38O4 — CID 51356545
(3E,5E,8S,9E,11S,12R,13E,15E,18R)-11,18-diethyl-8,12-dihydroxy-3,9,13,15-tetramethyl-1-oxacyclooctadeca-3,5,9,13,15-pentaen-2-one (PubChem CID 51356545) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is (3E,5E,8S,9E,11S,12R,13E,15E,18R)-11,18-diethyl-8,12-dihydroxy-3,9,13,15-tetramethyl-1-oxacyclooctadeca-3,5,9,13,15-pentaen-2-one.
| Compound Name | (3E,5E,8S,9E,11S,12R,13E,15E,18R)-11,18-diethyl-8,12-dihydroxy-3,9,13,15-tetramethyl-1-oxacyclooctadeca-3,5,9,13,15-pentaen-2-one |
|---|---|
| PubChem CID | 51356545 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (3E,5E,8S,9E,11S,12R,13E,15E,18R)-11,18-diethyl-8,12-dihydroxy-3,9,13,15-tetramethyl-1-oxacyclooctadeca-3,5,9,13,15-pentaen-2-one |
| SMILES | CC[C@@H]1C/C=C(C)/C=C(\C)[C@H](O)[C@@H](CC)/C=C(\C)[C@@H](O)C/C=C/C=C(\C)C(=O)O1 |
| InChI | InChI=1S/C25H38O4/c1-7-21-16-19(5)23(26)12-10-9-11-18(4)25(28)29-22(8-2)14-13-17(3)15-20(6)24(21)27/h9-11,13,15-16,21-24,26-27H,7-8,12,14H2,1-6H3/b10-9+,17-13+,18-11+,19-16+,20-15+/t21-,22+,23-,24-/m0/s1 |
| InChIKey | ZYMOTLXHSKMQSH-TYFPICQPSA-N |
| XLogP | 5.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|