C18H30O5 — CID 70676560
ethyl (2E,4E,8R,9R)-7-hydroxy-9-(methoxymethoxy)-4,8-dimethyldodeca-2,4,11-trienoate (PubChem CID 70676560) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is ethyl (2E,4E,8R,9R)-7-hydroxy-9-(methoxymethoxy)-4,8-dimethyldodeca-2,4,11-trienoate.
| Compound Name | ethyl (2E,4E,8R,9R)-7-hydroxy-9-(methoxymethoxy)-4,8-dimethyldodeca-2,4,11-trienoate |
|---|---|
| PubChem CID | 70676560 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | ethyl (2E,4E,8R,9R)-7-hydroxy-9-(methoxymethoxy)-4,8-dimethyldodeca-2,4,11-trienoate |
| SMILES | C=CC[C@@H](OCOC)[C@H](C)C(O)C/C=C(C)/C=C/C(=O)OCC |
| InChI | InChI=1S/C18H30O5/c1-6-8-17(23-13-21-5)15(4)16(19)11-9-14(3)10-12-18(20)22-7-2/h6,9-10,12,15-17,19H,1,7-8,11,13H2,2-5H3/b12-10+,14-9+/t15-,16?,17-/m1/s1 |
| InChIKey | WJRYQWSUWTYGBU-BXHSKRNBSA-N |
| XLogP | 3.00 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|