C16H26Br2O4 — CID 10575175
ethyl (2E,4S,6S,7S)-9,9-dibromo-7-(methoxymethoxy)-2,4,6-trimethylnona-2,8-dienoate (PubChem CID 10575175) has the molecular formula C16H26Br2O4 and a molecular weight of 442.19 g/mol. Its IUPAC name is ethyl (2E,4S,6S,7S)-9,9-dibromo-7-(methoxymethoxy)-2,4,6-trimethylnona-2,8-dienoate.
| Compound Name | ethyl (2E,4S,6S,7S)-9,9-dibromo-7-(methoxymethoxy)-2,4,6-trimethylnona-2,8-dienoate |
|---|---|
| PubChem CID | 10575175 |
| Molecular Formula | C16H26Br2O4 |
| Molecular Weight | 442.19 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | ethyl (2E,4S,6S,7S)-9,9-dibromo-7-(methoxymethoxy)-2,4,6-trimethylnona-2,8-dienoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](C)C[C@H](C)[C@@H](C=C(Br)Br)OCOC |
| InChI | InChI=1S/C16H26Br2O4/c1-6-21-16(19)13(4)8-11(2)7-12(3)14(9-15(17)18)22-10-20-5/h8-9,11-12,14H,6-7,10H2,1-5H3/b13-8+/t11-,12-,14+/m0/s1 |
| InChIKey | PEHBIXQMTOLHSM-OBVFRDKPSA-N |
| XLogP | 4.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.19 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|