C21H35BrO6 — CID 135014772
ethyl (2Z,4R,5S,6E,9S)-11-(bromomethyl)-5,9-bis(methoxymethoxy)-3,4-dimethyldodeca-2,6,11-trienoate (PubChem CID 135014772) has the molecular formula C21H35BrO6 and a molecular weight of 463.41 g/mol. Its IUPAC name is ethyl (2Z,4R,5S,6E,9S)-11-(bromomethyl)-5,9-bis(methoxymethoxy)-3,4-dimethyldodeca-2,6,11-trienoate.
| Compound Name | ethyl (2Z,4R,5S,6E,9S)-11-(bromomethyl)-5,9-bis(methoxymethoxy)-3,4-dimethyldodeca-2,6,11-trienoate |
|---|---|
| PubChem CID | 135014772 |
| Molecular Formula | C21H35BrO6 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | ethyl (2Z,4R,5S,6E,9S)-11-(bromomethyl)-5,9-bis(methoxymethoxy)-3,4-dimethyldodeca-2,6,11-trienoate |
| SMILES | C=C(CBr)C[C@H](C/C=C/[C@H](OCOC)[C@H](C)/C(C)=C\C(=O)OCC)OCOC |
| InChI | InChI=1S/C21H35BrO6/c1-7-26-21(23)12-17(3)18(4)20(28-15-25-6)10-8-9-19(27-14-24-5)11-16(2)13-22/h8,10,12,18-20H,2,7,9,11,13-15H2,1,3-6H3/b10-8+,17-12-/t18-,19+,20+/m1/s1 |
| InChIKey | ADVMBVVPUNOULN-LNMJOVQRSA-N |
| XLogP | 4.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|