C16H28O5 — CID 70676558
ethyl (2E,4E,7S,8R,9R)-7-hydroxy-9-(methoxymethoxy)-4,8-dimethyldeca-2,4-dienoate (PubChem CID 70676558) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethyl (2E,4E,7S,8R,9R)-7-hydroxy-9-(methoxymethoxy)-4,8-dimethyldeca-2,4-dienoate.
| Compound Name | ethyl (2E,4E,7S,8R,9R)-7-hydroxy-9-(methoxymethoxy)-4,8-dimethyldeca-2,4-dienoate |
|---|---|
| PubChem CID | 70676558 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | ethyl (2E,4E,7S,8R,9R)-7-hydroxy-9-(methoxymethoxy)-4,8-dimethyldeca-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(C)=C/C[C@H](O)[C@@H](C)[C@@H](C)OCOC |
| InChI | InChI=1S/C16H28O5/c1-6-20-16(18)10-8-12(2)7-9-15(17)13(3)14(4)21-11-19-5/h7-8,10,13-15,17H,6,9,11H2,1-5H3/b10-8+,12-7+/t13-,14+,15-/m0/s1 |
| InChIKey | LASOSSRIAGCLQE-OOIRRFJISA-N |
| XLogP | 2.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|