C22H40O5Si — CID 139252223
ethyl (2E,4E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-8-(2-methyl-1,3-dioxolan-2-yl)octa-2,4-dienoate (PubChem CID 139252223) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is ethyl (2E,4E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-8-(2-methyl-1,3-dioxolan-2-yl)octa-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-8-(2-methyl-1,3-dioxolan-2-yl)octa-2,4-dienoate |
|---|---|
| PubChem CID | 139252223 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | ethyl (2E,4E,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyl-8-(2-methyl-1,3-dioxolan-2-yl)octa-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(C)=C/[C@@H](C)[C@@H](CC1(C)OCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O5Si/c1-10-24-20(23)12-11-17(2)15-18(3)19(16-22(7)25-13-14-26-22)27-28(8,9)21(4,5)6/h11-12,15,18-19H,10,13-14,16H2,1-9H3/b12-11+,17-15+/t18-,19-/m1/s1 |
| InChIKey | ZXLHCMOJBJSUPW-GMVAFRFFSA-N |
| XLogP | 5.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|