C26H48O3Si — CID 57058828
tert-butyl-dimethyl-[2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-1,6,10-trien-3-yl]oxysilane (PubChem CID 57058828) has the molecular formula C26H48O3Si and a molecular weight of 436.75 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-1,6,10-trien-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-1,6,10-trien-3-yl]oxysilane |
|---|---|
| PubChem CID | 57058828 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | tert-butyl-dimethyl-[2,6,10-trimethyl-12-(oxan-2-yloxy)dodeca-1,6,10-trien-3-yl]oxysilane |
| SMILES | C=C(C)C(CCC(C)=CCCC(C)=CCOC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O3Si/c1-21(2)24(29-30(8,9)26(5,6)7)17-16-22(3)13-12-14-23(4)18-20-28-25-15-10-11-19-27-25/h13,18,24-25H,1,10-12,14-17,19-20H2,2-9H3 |
| InChIKey | OHHIEULSRSIEBF-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|