C19H38O3Si — CID 135076590
hydroxy-[(E)-1-(oxan-2-yloxy)oct-2-en-2-yl]-di(propan-2-yl)silane (PubChem CID 135076590) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is hydroxy-[(E)-1-(oxan-2-yloxy)oct-2-en-2-yl]-di(propan-2-yl)silane.
| Compound Name | hydroxy-[(E)-1-(oxan-2-yloxy)oct-2-en-2-yl]-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 135076590 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | hydroxy-[(E)-1-(oxan-2-yloxy)oct-2-en-2-yl]-di(propan-2-yl)silane |
| SMILES | CCCCC/C=C(\COC1CCCCO1)[Si](O)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H38O3Si/c1-6-7-8-9-12-18(23(20,16(2)3)17(4)5)15-22-19-13-10-11-14-21-19/h12,16-17,19-20H,6-11,13-15H2,1-5H3/b18-12+ |
| InChIKey | QVUFPVOWSDHUME-LDADJPATSA-N |
| XLogP | 5.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|