C30H56O3Si — CID 10791321
tert-butyl-[(2E,6Z,10E)-7-(diethoxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenoxy]-dimethylsilane (PubChem CID 10791321) has the molecular formula C30H56O3Si and a molecular weight of 492.86 g/mol. Its IUPAC name is tert-butyl-[(2E,6Z,10E)-7-(diethoxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6Z,10E)-7-(diethoxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10791321 |
| Molecular Formula | C30H56O3Si |
| Molecular Weight | 492.86 g/mol |
| Exact Mass | 492.40 |
| IUPAC Name | tert-butyl-[(2E,6Z,10E)-7-(diethoxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenoxy]-dimethylsilane |
| SMILES | CCOC(OCC)/C(=C\CC/C(C)=C/CO[Si](C)(C)C(C)(C)C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H56O3Si/c1-12-31-29(32-13-2)28(21-15-19-26(5)18-14-17-25(3)4)22-16-20-27(6)23-24-33-34(10,11)30(7,8)9/h17,19,22-23,29H,12-16,18,20-21,24H2,1-11H3/b26-19+,27-23+,28-22- |
| InChIKey | HYFWQDJLPPUZLY-VTAZOKJLSA-N |
| XLogP | 9.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.86 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|