C21H41IO2Si — CID 134879161
tert-butyl-[1-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-iodo-2-methylbutoxy]-dimethylsilane (PubChem CID 134879161) has the molecular formula C21H41IO2Si and a molecular weight of 480.55 g/mol. Its IUPAC name is tert-butyl-[1-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-iodo-2-methylbutoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-iodo-2-methylbutoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134879161 |
| Molecular Formula | C21H41IO2Si |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | tert-butyl-[1-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-iodo-2-methylbutoxy]-dimethylsilane |
| SMILES | CCC(C)(I)C(OC/C=C(\C)CCC=C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H41IO2Si/c1-11-21(8,22)19(24-25(9,10)20(5,6)7)23-16-15-18(4)14-12-13-17(2)3/h13,15,19H,11-12,14,16H2,1-10H3/b18-15+ |
| InChIKey | SQWAZTPTLLCYBX-OBGWFSINSA-N |
| XLogP | 7.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|