C22H45IO2Si — CID 15213976
tert-butyl-[1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane (PubChem CID 15213976) has the molecular formula C22H45IO2Si and a molecular weight of 496.59 g/mol. Its IUPAC name is tert-butyl-[1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane |
|---|---|
| PubChem CID | 15213976 |
| Molecular Formula | C22H45IO2Si |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | tert-butyl-[1-[(E)-hex-2-enoxy]-2-iododecoxy]-dimethylsilane |
| SMILES | CCC/C=C/COC(O[Si](C)(C)C(C)(C)C)C(I)CCCCCCCC |
| InChI | InChI=1S/C22H45IO2Si/c1-8-10-12-14-15-16-18-20(23)21(24-19-17-13-11-9-2)25-26(6,7)22(3,4)5/h13,17,20-21H,8-12,14-16,18-19H2,1-7H3/b17-13+ |
| InChIKey | KLKRSKNKGGSAPS-GHRIWEEISA-N |
| XLogP | 8.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|