C22H43IO2Si — CID 10601271
tert-butyl-[(1S,2S)-1-cyclohex-2-en-1-yloxy-2-iododecoxy]-dimethylsilane (PubChem CID 10601271) has the molecular formula C22H43IO2Si and a molecular weight of 494.57 g/mol. Its IUPAC name is tert-butyl-[(1S,2S)-1-cyclohex-2-en-1-yloxy-2-iododecoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2S)-1-cyclohex-2-en-1-yloxy-2-iododecoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10601271 |
| Molecular Formula | C22H43IO2Si |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | tert-butyl-[(1S,2S)-1-cyclohex-2-en-1-yloxy-2-iododecoxy]-dimethylsilane |
| SMILES | CCCCCCCC[C@H](I)[C@@H](OC1C=CCCC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H43IO2Si/c1-7-8-9-10-11-15-18-20(23)21(24-19-16-13-12-14-17-19)25-26(5,6)22(2,3)4/h13,16,19-21H,7-12,14-15,17-18H2,1-6H3/t19?,20-,21-/m0/s1 |
| InChIKey | LZONMLMFCRJPRY-AKQSQHNNSA-N |
| XLogP | 8.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|