C19H39IO2Si — CID 10789888
tert-butyl-[2-iodo-1-[(E)-undec-2-en-4-yl]oxyethoxy]-dimethylsilane (PubChem CID 10789888) has the molecular formula C19H39IO2Si and a molecular weight of 454.51 g/mol. Its IUPAC name is tert-butyl-[2-iodo-1-[(E)-undec-2-en-4-yl]oxyethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-iodo-1-[(E)-undec-2-en-4-yl]oxyethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10789888 |
| Molecular Formula | C19H39IO2Si |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | tert-butyl-[2-iodo-1-[(E)-undec-2-en-4-yl]oxyethoxy]-dimethylsilane |
| SMILES | C/C=C/C(CCCCCCC)OC(CI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H39IO2Si/c1-8-10-11-12-13-15-17(14-9-2)21-18(16-20)22-23(6,7)19(3,4)5/h9,14,17-18H,8,10-13,15-16H2,1-7H3/b14-9+ |
| InChIKey | OMXBREKZZWYZHH-NTEUORMPSA-N |
| XLogP | 7.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|