C19H38O3Si — CID 10315372
tert-butyl-[4-[3-(2-methoxypropan-2-yloxy)cyclopenten-1-yl]butoxy]-dimethylsilane (PubChem CID 10315372) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is tert-butyl-[4-[3-(2-methoxypropan-2-yloxy)cyclopenten-1-yl]butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[3-(2-methoxypropan-2-yloxy)cyclopenten-1-yl]butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10315372 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | tert-butyl-[4-[3-(2-methoxypropan-2-yloxy)cyclopenten-1-yl]butoxy]-dimethylsilane |
| SMILES | COC(C)(C)OC1C=C(CCCCO[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H38O3Si/c1-18(2,3)23(7,8)21-14-10-9-11-16-12-13-17(15-16)22-19(4,5)20-6/h15,17H,9-14H2,1-8H3 |
| InChIKey | KHMPZHLRDUTNES-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|