C16H31NOSi — CID 44543139
tert-butyl-[4-[(4E)-4-ethylidene-2,3-dihydropyrrol-5-yl]butoxy]-dimethylsilane (PubChem CID 44543139) has the molecular formula C16H31NOSi and a molecular weight of 281.52 g/mol. Its IUPAC name is tert-butyl-[4-[(4E)-4-ethylidene-2,3-dihydropyrrol-5-yl]butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[(4E)-4-ethylidene-2,3-dihydropyrrol-5-yl]butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 44543139 |
| Molecular Formula | C16H31NOSi |
| Molecular Weight | 281.52 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | tert-butyl-[4-[(4E)-4-ethylidene-2,3-dihydropyrrol-5-yl]butoxy]-dimethylsilane |
| SMILES | C/C=C1\CCN=C1CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31NOSi/c1-7-14-11-12-17-15(14)10-8-9-13-18-19(5,6)16(2,3)4/h7H,8-13H2,1-6H3/b14-7+ |
| InChIKey | GHMZDHDNZRHFAH-VGOFMYFVSA-N |
| XLogP | 4.97 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|