C27H55IO2Si — CID 134879163
tert-butyl-[2-iodo-1-[(E)-undec-2-en-4-yl]oxydecoxy]-dimethylsilane (PubChem CID 134879163) has the molecular formula C27H55IO2Si and a molecular weight of 566.73 g/mol. Its IUPAC name is tert-butyl-[2-iodo-1-[(E)-undec-2-en-4-yl]oxydecoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-iodo-1-[(E)-undec-2-en-4-yl]oxydecoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134879163 |
| Molecular Formula | C27H55IO2Si |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | tert-butyl-[2-iodo-1-[(E)-undec-2-en-4-yl]oxydecoxy]-dimethylsilane |
| SMILES | C/C=C/C(CCCCCCC)OC(O[Si](C)(C)C(C)(C)C)C(I)CCCCCCCC |
| InChI | InChI=1S/C27H55IO2Si/c1-9-12-14-16-18-20-23-25(28)26(30-31(7,8)27(4,5)6)29-24(21-11-3)22-19-17-15-13-10-2/h11,21,24-26H,9-10,12-20,22-23H2,1-8H3/b21-11+ |
| InChIKey | JKODEOJHGJCPPC-SRZZPIQSSA-N |
| XLogP | 10.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|