C19H36O3Si — CID 134880484
tert-butyl-[(E)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-methoxyethenoxy]-dimethylsilane (PubChem CID 134880484) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is tert-butyl-[(E)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-methoxyethenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-methoxyethenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134880484 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | tert-butyl-[(E)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1-methoxyethenoxy]-dimethylsilane |
| SMILES | CO/C(=C\OC/C=C(\C)CCC=C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-16(2)11-10-12-17(3)13-14-21-15-18(20-7)22-23(8,9)19(4,5)6/h11,13,15H,10,12,14H2,1-9H3/b17-13+,18-15+ |
| InChIKey | PSESJXXXCMZIOT-YUIMGRLZSA-N |
| XLogP | 6.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|