C21H39NO3Si — CID 10452460
(6S)-6-[(E,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylhex-1-enyl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile (PubChem CID 10452460) has the molecular formula C21H39NO3Si and a molecular weight of 381.63 g/mol. Its IUPAC name is (6S)-6-[(E,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylhex-1-enyl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile.
| Compound Name | (6S)-6-[(E,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylhex-1-enyl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile |
|---|---|
| PubChem CID | 10452460 |
| Molecular Formula | C21H39NO3Si |
| Molecular Weight | 381.63 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | (6S)-6-[(E,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethylhex-1-enyl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/[C@@H]1CC(C#N)OC(C)(C)O1 |
| InChI | InChI=1S/C21H39NO3Si/c1-15(2)19(25-26(9,10)20(4,5)6)16(3)11-12-17-13-18(14-22)24-21(7,8)23-17/h11-12,15-19H,13H2,1-10H3/b12-11+/t16-,17-,18?,19-/m1/s1 |
| InChIKey | ANEDTPUOOKVSDG-WECCVSSOSA-N |
| XLogP | 5.66 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|