C25H46O3SSi — CID 134875605
tert-butyl-[(1E,5E)-3,5-dimethyl-1-[(4R,5R,6R)-2,2,5-trimethyl-6-[(E)-2-methylsulfanylethenyl]-1,3-dioxan-4-yl]hepta-1,5-dien-4-yl]oxy-dimethylsilane (PubChem CID 134875605) has the molecular formula C25H46O3SSi and a molecular weight of 454.79 g/mol. Its IUPAC name is tert-butyl-[(1E,5E)-3,5-dimethyl-1-[(4R,5R,6R)-2,2,5-trimethyl-6-[(E)-2-methylsulfanylethenyl]-1,3-dioxan-4-yl]hepta-1,5-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,5E)-3,5-dimethyl-1-[(4R,5R,6R)-2,2,5-trimethyl-6-[(E)-2-methylsulfanylethenyl]-1,3-dioxan-4-yl]hepta-1,5-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134875605 |
| Molecular Formula | C25H46O3SSi |
| Molecular Weight | 454.79 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | tert-butyl-[(1E,5E)-3,5-dimethyl-1-[(4R,5R,6R)-2,2,5-trimethyl-6-[(E)-2-methylsulfanylethenyl]-1,3-dioxan-4-yl]hepta-1,5-dien-4-yl]oxy-dimethylsilane |
| SMILES | C/C=C(\C)C(O[Si](C)(C)C(C)(C)C)C(C)/C=C/[C@H]1OC(C)(C)O[C@@H](/C=C/SC)[C@@H]1C |
| InChI | InChI=1S/C25H46O3SSi/c1-13-18(2)23(28-30(11,12)24(5,6)7)19(3)14-15-21-20(4)22(16-17-29-10)27-25(8,9)26-21/h13-17,19-23H,1-12H3/b15-14+,17-16+,18-13+/t19?,20-,21-,22+,23?/m1/s1 |
| InChIKey | BGCTWBZZCOMKTL-WUYOLUKZSA-N |
| XLogP | 7.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.79 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|