C16H32O3Si — CID 10380090
tert-butyl-[[(2S,3S,6S)-6-methoxy-3-propan-2-yl-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane (PubChem CID 10380090) has the molecular formula C16H32O3Si and a molecular weight of 300.51 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S,6S)-6-methoxy-3-propan-2-yl-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,3S,6S)-6-methoxy-3-propan-2-yl-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10380090 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | tert-butyl-[[(2S,3S,6S)-6-methoxy-3-propan-2-yl-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane |
| SMILES | CO[C@@H]1C=C[C@H](C(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H32O3Si/c1-12(2)13-9-10-15(17-6)19-14(13)11-18-20(7,8)16(3,4)5/h9-10,12-15H,11H2,1-8H3/t13-,14-,15+/m1/s1 |
| InChIKey | CHOKBEDVZXMCFG-KFWWJZLASA-N |
| XLogP | 4.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|