C26H46O3Si2 — CID 135067652
triethyl-[[(1S,2R,5R,6R)-3-(3-methylbut-3-en-1-ynyl)-5-tri(propan-2-yl)silyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl]oxy]silane (PubChem CID 135067652) has the molecular formula C26H46O3Si2 and a molecular weight of 462.82 g/mol. Its IUPAC name is triethyl-[[(1S,2R,5R,6R)-3-(3-methylbut-3-en-1-ynyl)-5-tri(propan-2-yl)silyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl]oxy]silane.
| Compound Name | triethyl-[[(1S,2R,5R,6R)-3-(3-methylbut-3-en-1-ynyl)-5-tri(propan-2-yl)silyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl]oxy]silane |
|---|---|
| PubChem CID | 135067652 |
| Molecular Formula | C26H46O3Si2 |
| Molecular Weight | 462.82 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | triethyl-[[(1S,2R,5R,6R)-3-(3-methylbut-3-en-1-ynyl)-5-tri(propan-2-yl)silyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl]oxy]silane |
| SMILES | C=C(C)C#CC1=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]2O[C@@H]2[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C26H46O3Si2/c1-12-30(13-2,14-3)29-24-22(16-15-18(4)5)17-23(25-26(24)27-25)28-31(19(6)7,20(8)9)21(10)11/h17,19-21,23-26H,4,12-14H2,1-3,5-11H3/t23-,24-,25+,26-/m1/s1 |
| InChIKey | ROHZSMNPSLKLAQ-FXSWLTOZSA-N |
| XLogP | 7.22 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.82 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|