C17H26O3Si — CID 11023186
(1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(3-methylbut-3-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-en-2-ol (PubChem CID 11023186) has the molecular formula C17H26O3Si and a molecular weight of 306.48 g/mol. Its IUPAC name is (1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(3-methylbut-3-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-en-2-ol.
| Compound Name | (1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(3-methylbut-3-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-en-2-ol |
|---|---|
| PubChem CID | 11023186 |
| Molecular Formula | C17H26O3Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (1S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(3-methylbut-3-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-en-2-ol |
| SMILES | C=C(C)C#CC1=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[C@H]2C1O |
| InChI | InChI=1S/C17H26O3Si/c1-11(2)8-9-12-10-13(15-16(19-15)14(12)18)20-21(6,7)17(3,4)5/h10,13-16,18H,1H2,2-7H3/t13-,14?,15+,16-/m0/s1 |
| InChIKey | DDWZJVMSNNMDPV-NJWZKDKTSA-N |
| XLogP | 3.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|