C12H21IO3Si — CID 11003118
(1R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-iodo-7-oxabicyclo[4.1.0]hept-3-en-2-ol (PubChem CID 11003118) has the molecular formula C12H21IO3Si and a molecular weight of 368.29 g/mol. Its IUPAC name is (1R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-iodo-7-oxabicyclo[4.1.0]hept-3-en-2-ol.
| Compound Name | (1R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-iodo-7-oxabicyclo[4.1.0]hept-3-en-2-ol |
|---|---|
| PubChem CID | 11003118 |
| Molecular Formula | C12H21IO3Si |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | (1R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-iodo-7-oxabicyclo[4.1.0]hept-3-en-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C(I)C(O)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C12H21IO3Si/c1-12(2,3)17(4,5)16-8-6-7(13)9(14)11-10(8)15-11/h6,8-11,14H,1-5H3/t8-,9?,10+,11-/m1/s1 |
| InChIKey | YLKIWOYLLAFLNG-TVTJGUELSA-N |
| XLogP | 2.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|