C18H37IO3Si2 — CID 53474127
(1R,4R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclohex-2-en-1-ol (PubChem CID 53474127) has the molecular formula C18H37IO3Si2 and a molecular weight of 484.57 g/mol. Its IUPAC name is (1R,4R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclohex-2-en-1-ol.
| Compound Name | (1R,4R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 53474127 |
| Molecular Formula | C18H37IO3Si2 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (1R,4R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclohex-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C(I)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H37IO3Si2/c1-17(2,3)23(7,8)21-13-11-14(19)16(20)15(12-13)22-24(9,10)18(4,5)6/h11,13,15-16,20H,12H2,1-10H3/t13-,15+,16-/m0/s1 |
| InChIKey | GPWKSIZBEBCPSC-IMJJTQAJSA-N |
| XLogP | 5.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|