C24H52O4Si3 — CID 91998628
(1S,4R,5S,6S)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-ol (PubChem CID 91998628) has the molecular formula C24H52O4Si3 and a molecular weight of 488.93 g/mol. Its IUPAC name is (1S,4R,5S,6S)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-ol.
| Compound Name | (1S,4R,5S,6S)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 91998628 |
| Molecular Formula | C24H52O4Si3 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | (1S,4R,5S,6S)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C=C[C@@H]1O |
| InChI | InChI=1S/C24H52O4Si3/c1-22(2,3)29(10,11)26-19-17-16-18(25)20(27-30(12,13)23(4,5)6)21(19)28-31(14,15)24(7,8)9/h16-21,25H,1-15H3/t18-,19+,20-,21-/m0/s1 |
| InChIKey | SQFRTQYODFLOFT-WOZUAGRISA-N |
| XLogP | 7.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|