C12H23IO2Si — CID 139249221
(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-iodocyclohex-2-en-1-ol (PubChem CID 139249221) has the molecular formula C12H23IO2Si and a molecular weight of 354.30 g/mol. Its IUPAC name is (1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-iodocyclohex-2-en-1-ol.
| Compound Name | (1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-iodocyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 139249221 |
| Molecular Formula | C12H23IO2Si |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-iodocyclohex-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC=C(I)[C@@H]1O |
| InChI | InChI=1S/C12H23IO2Si/c1-12(2,3)16(4,5)15-10-8-6-7-9(13)11(10)14/h7,10-11,14H,6,8H2,1-5H3/t10-,11+/m1/s1 |
| InChIKey | PBSIUOBAFFPPFU-MNOVXSKESA-N |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|