C19H32O5Si — CID 139250475
[(1S,2R,6S)-4-[(E)-3-hydroxy-3-methylbut-1-enyl]-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate (PubChem CID 139250475) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is [(1S,2R,6S)-4-[(E)-3-hydroxy-3-methylbut-1-enyl]-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate.
| Compound Name | [(1S,2R,6S)-4-[(E)-3-hydroxy-3-methylbut-1-enyl]-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 139250475 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | [(1S,2R,6S)-4-[(E)-3-hydroxy-3-methylbut-1-enyl]-5-triethylsilyloxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
| SMILES | CC[Si](CC)(CC)OC1C(/C=C/C(C)(C)O)=C[C@@H](OC(C)=O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C19H32O5Si/c1-7-25(8-2,9-3)24-16-14(10-11-19(5,6)21)12-15(22-13(4)20)17-18(16)23-17/h10-12,15-18,21H,7-9H2,1-6H3/b11-10+/t15-,16?,17+,18-/m1/s1 |
| InChIKey | IVZZLLWKEFVCSN-XQFAPZHLSA-N |
| XLogP | 3.34 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|