C15H26O4Si — CID 46187582
[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-oxiran-2-yl]but-3-enyl] prop-2-enoate (PubChem CID 46187582) has the molecular formula C15H26O4Si and a molecular weight of 298.46 g/mol. Its IUPAC name is [(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-oxiran-2-yl]but-3-enyl] prop-2-enoate.
| Compound Name | [(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-oxiran-2-yl]but-3-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 46187582 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-oxiran-2-yl]but-3-enyl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H]([C@@H](C=C)O[Si](C)(C)C(C)(C)C)[C@H]1CO1 |
| InChI | InChI=1S/C15H26O4Si/c1-8-11(19-20(6,7)15(3,4)5)14(12-10-17-12)18-13(16)9-2/h8-9,11-12,14H,1-2,10H2,3-7H3/t11-,12-,14+/m1/s1 |
| InChIKey | TYGOWLGGYINTES-BZPMIXESSA-N |
| XLogP | 3.06 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|