C14H26O4Si — CID 135041456
ethyl (E)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]prop-2-enoate (PubChem CID 135041456) has the molecular formula C14H26O4Si and a molecular weight of 286.44 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 135041456 |
| Molecular Formula | C14H26O4Si |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | ethyl (E)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O4Si/c1-7-16-13(15)9-8-11-12(18-11)10-17-19(5,6)14(2,3)4/h8-9,11-12H,7,10H2,1-6H3/b9-8+/t11-,12-/m0/s1 |
| InChIKey | XKSMGPQVOWSBNG-OMJLJAAMSA-N |
| XLogP | 2.89 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|