C14H28O3Si — CID 25023044
[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-1-en-3-yl] acetate (PubChem CID 25023044) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-1-en-3-yl] acetate.
| Compound Name | [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 25023044 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | [(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxyhex-1-en-3-yl] acetate |
| SMILES | C=C[C@@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C14H28O3Si/c1-9-13(16-12(3)15)10-11(2)17-18(7,8)14(4,5)6/h9,11,13H,1,10H2,2-8H3/t11-,13+/m1/s1 |
| InChIKey | YKMUPNGAHFVPDL-YPMHNXCESA-N |
| XLogP | 3.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|