C17H34O3Si — CID 102029881
[(E)-1-tri(propan-2-yl)silyloxyhex-4-en-3-yl] acetate (PubChem CID 102029881) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is [(E)-1-tri(propan-2-yl)silyloxyhex-4-en-3-yl] acetate.
| Compound Name | [(E)-1-tri(propan-2-yl)silyloxyhex-4-en-3-yl] acetate |
|---|---|
| PubChem CID | 102029881 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | [(E)-1-tri(propan-2-yl)silyloxyhex-4-en-3-yl] acetate |
| SMILES | C/C=C/C(CCO[Si](C(C)C)(C(C)C)C(C)C)OC(C)=O |
| InChI | InChI=1S/C17H34O3Si/c1-9-10-17(20-16(8)18)11-12-19-21(13(2)3,14(4)5)15(6)7/h9-10,13-15,17H,11-12H2,1-8H3/b10-9+ |
| InChIKey | FVPZZGTYTJBVIC-MDZDMXLPSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|