C18H24O4Si — CID 45113979
[(4S)-4-acetyloxy-11-trimethylsilylundeca-5,6-dien-8,10-diynyl] acetate (PubChem CID 45113979) has the molecular formula C18H24O4Si and a molecular weight of 332.47 g/mol. Its IUPAC name is [(4S)-4-acetyloxy-11-trimethylsilylundeca-5,6-dien-8,10-diynyl] acetate.
| Compound Name | [(4S)-4-acetyloxy-11-trimethylsilylundeca-5,6-dien-8,10-diynyl] acetate |
|---|---|
| PubChem CID | 45113979 |
| Molecular Formula | C18H24O4Si |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [(4S)-4-acetyloxy-11-trimethylsilylundeca-5,6-dien-8,10-diynyl] acetate |
| SMILES | CC(=O)OCCC[C@@H](C=C=CC#CC#C[Si](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C18H24O4Si/c1-16(19)21-14-11-13-18(22-17(2)20)12-9-7-6-8-10-15-23(3,4)5/h7,12,18H,11,13-14H2,1-5H3/t9?,18-/m1/s1 |
| InChIKey | YJWAFLPTGSSEPD-ROGCICSOSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|