C19H33IO5Si — CID 11156200
[(E,2E)-3-acetyloxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6-iodohept-5-enyl] acetate (PubChem CID 11156200) has the molecular formula C19H33IO5Si and a molecular weight of 496.46 g/mol. Its IUPAC name is [(E,2E)-3-acetyloxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6-iodohept-5-enyl] acetate.
| Compound Name | [(E,2E)-3-acetyloxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6-iodohept-5-enyl] acetate |
|---|---|
| PubChem CID | 11156200 |
| Molecular Formula | C19H33IO5Si |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [(E,2E)-3-acetyloxy-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6-iodohept-5-enyl] acetate |
| SMILES | CC(=O)OC/C(=C\CO[Si](C)(C)C(C)(C)C)C(C/C=C(\C)I)OC(C)=O |
| InChI | InChI=1S/C19H33IO5Si/c1-14(20)9-10-18(25-16(3)22)17(13-23-15(2)21)11-12-24-26(7,8)19(4,5)6/h9,11,18H,10,12-13H2,1-8H3/b14-9+,17-11+ |
| InChIKey | BLUVPAIDSUQJNU-UHECJYLPSA-N |
| XLogP | 5.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|