C22H40O3Si — CID 11589008
methyl (2E,6E)-9-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,10-trienoate (PubChem CID 11589008) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is methyl (2E,6E)-9-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,10-trienoate.
| Compound Name | methyl (2E,6E)-9-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 11589008 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | methyl (2E,6E)-9-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,10-trienoate |
| SMILES | COC(=O)/C=C(\C)CC/C=C(\C)CC(C=C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O3Si/c1-17(2)14-20(25-26(9,10)22(5,6)7)15-18(3)12-11-13-19(4)16-21(23)24-8/h12,14,16,20H,11,13,15H2,1-10H3/b18-12+,19-16+ |
| InChIKey | KZNYZTYPGPLSSZ-WBLKYFKXSA-N |
| XLogP | 6.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|