C21H36O3Si — CID 135046761
methyl (2Z,6E)-3-[tert-butyl(dimethyl)silyl]oxy-10-cyclopropylidene-7-methyldeca-2,6-dienoate (PubChem CID 135046761) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is methyl (2Z,6E)-3-[tert-butyl(dimethyl)silyl]oxy-10-cyclopropylidene-7-methyldeca-2,6-dienoate.
| Compound Name | methyl (2Z,6E)-3-[tert-butyl(dimethyl)silyl]oxy-10-cyclopropylidene-7-methyldeca-2,6-dienoate |
|---|---|
| PubChem CID | 135046761 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | methyl (2Z,6E)-3-[tert-butyl(dimethyl)silyl]oxy-10-cyclopropylidene-7-methyldeca-2,6-dienoate |
| SMILES | COC(=O)/C=C(/CC/C=C(\C)CCC=C1CC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-17(10-8-12-18-14-15-18)11-9-13-19(16-20(22)23-5)24-25(6,7)21(2,3)4/h11-12,16H,8-10,13-15H2,1-7H3/b17-11+,19-16- |
| InChIKey | ZLODLVXUWKISTI-IIIOKWFNSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|