C21H38O3Si — CID 14805433
methyl (2E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-7,11-dimethyldodeca-2,6,10-trienoate (PubChem CID 14805433) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is methyl (2E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-7,11-dimethyldodeca-2,6,10-trienoate.
| Compound Name | methyl (2E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-7,11-dimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 14805433 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | methyl (2E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-7,11-dimethyldodeca-2,6,10-trienoate |
| SMILES | COC(=O)/C=C/CC/C=C(\C)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O3Si/c1-18(13-10-9-11-16-20(22)23-6)14-12-15-19(2)17-24-25(7,8)21(3,4)5/h11,13,15-16H,9-10,12,14,17H2,1-8H3/b16-11+,18-13+,19-15+ |
| InChIKey | XHLJIKJJQUIEKJ-KZCKDZMOSA-N |
| XLogP | 6.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|