About methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate
methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate (PubChem CID 11010538) has the molecular formula C14H26O2Si
and a molecular weight of 254.45 g/mol. Its IUPAC name is methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate.
Molecular Properties
| Compound Name | methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate |
| PubChem CID | 11010538 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate |
| SMILES | COC(=O)/C=C(/CCC=C(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C14H26O2Si/c1-12(2)8-7-9-13(10-14(15)16-3)11-17(4,5)6/h8,10H,7,9,11H2,1-6H3/b13-10- |
| InChIKey | DTKIKDKKJOEZHB-RAXLEYEMSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate?
The IUPAC name of methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate (CID 11010538) is methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate.
What is the SMILES notation for methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate?
The canonical SMILES for methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate is COC(=O)/C=C(/CCC=C(C)C)C[Si](C)(C)C.
What is the InChIKey of methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate?
The InChIKey is DTKIKDKKJOEZHB-RAXLEYEMSA-N. The full InChI is InChI=1S/C14H26O2Si/c1-12(2)8-7-9-13(10-14(15)16-3)11-17(4,5)6/h8,10H,7,9,11H2,1-6H3/b13-10-.
What are the key properties of methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate?
methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate has a molecular weight of 254.45 g/mol, XLogP of 4.17, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-7-methyl-3-(trimethylsilylmethyl)octa-2,6-dienoate is sourced from PubChem (CID 11010538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).