C32H62O3SiSn — CID 135053764
methyl (2E,4Z)-8-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethyl-4-tributylstannylundeca-2,4,9-trienoate (PubChem CID 135053764) has the molecular formula C32H62O3SiSn and a molecular weight of 641.64 g/mol. Its IUPAC name is methyl (2E,4Z)-8-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethyl-4-tributylstannylundeca-2,4,9-trienoate.
| Compound Name | methyl (2E,4Z)-8-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethyl-4-tributylstannylundeca-2,4,9-trienoate |
|---|---|
| PubChem CID | 135053764 |
| Molecular Formula | C32H62O3SiSn |
| Molecular Weight | 641.64 g/mol |
| Exact Mass | 642.35 |
| IUPAC Name | methyl (2E,4Z)-8-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethyl-4-tributylstannylundeca-2,4,9-trienoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(=C\CCC(C=C(C)C)O[Si](C)(C)C(C)(C)C)/C(C)=C/C(=O)OC |
| InChI | InChI=1S/C20H35O3Si.3C4H9.Sn/c1-16(2)14-18(23-24(8,9)20(4,5)6)13-11-10-12-17(3)15-19(21)22-7;3*1-3-4-2;/h10,14-15,18H,11,13H2,1-9H3;3*1,3-4H2,2H3;/b12-10?,17-15+;;;; |
| InChIKey | JYABYUCGGKYHAG-FAZRASSWSA-N |
| XLogP | 10.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.64 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|